C17H16BrNO2S — CID 13349625
3-bromo-1-(2,4,6-trimethylphenyl)sulfonylindole (PubChem CID 13349625) has the molecular formula C17H16BrNO2S and a molecular weight of 378.29 g/mol. Its IUPAC name is 3-bromo-1-(2,4,6-trimethylphenyl)sulfonylindole.
| Compound Name | 3-bromo-1-(2,4,6-trimethylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 13349625 |
| Molecular Formula | C17H16BrNO2S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 3-bromo-1-(2,4,6-trimethylphenyl)sulfonylindole |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc(Br)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C17H16BrNO2S/c1-11-8-12(2)17(13(3)9-11)22(20,21)19-10-15(18)14-6-4-5-7-16(14)19/h4-10H,1-3H3 |
| InChIKey | CFKVPUXQDYQNML-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |