C22H26BrN3O2S — CID 45111164
1-[4-bromo-3-[(4-ethylpiperazin-1-yl)methyl]phenyl]sulfonyl-3-methylindole (PubChem CID 45111164) has the molecular formula C22H26BrN3O2S and a molecular weight of 476.44 g/mol. Its IUPAC name is 1-[4-bromo-3-[(4-ethylpiperazin-1-yl)methyl]phenyl]sulfonyl-3-methylindole.
| Compound Name | 1-[4-bromo-3-[(4-ethylpiperazin-1-yl)methyl]phenyl]sulfonyl-3-methylindole |
|---|---|
| PubChem CID | 45111164 |
| Molecular Formula | C22H26BrN3O2S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 1-[4-bromo-3-[(4-ethylpiperazin-1-yl)methyl]phenyl]sulfonyl-3-methylindole |
| SMILES | CCN1CCN(Cc2cc(S(=O)(=O)n3cc(C)c4ccccc43)ccc2Br)CC1 |
| InChI | InChI=1S/C22H26BrN3O2S/c1-3-24-10-12-25(13-11-24)16-18-14-19(8-9-21(18)23)29(27,28)26-15-17(2)20-6-4-5-7-22(20)26/h4-9,14-15H,3,10-13,16H2,1-2H3 |
| InChIKey | BNFJHTKBCZDFKQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |