C22H26BrN3O3S — CID 45111160
1-[4-bromo-3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfonyl-5-methoxy-3-methylindole (PubChem CID 45111160) has the molecular formula C22H26BrN3O3S and a molecular weight of 492.44 g/mol. Its IUPAC name is 1-[4-bromo-3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfonyl-5-methoxy-3-methylindole.
| Compound Name | 1-[4-bromo-3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfonyl-5-methoxy-3-methylindole |
|---|---|
| PubChem CID | 45111160 |
| Molecular Formula | C22H26BrN3O3S |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 1-[4-bromo-3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfonyl-5-methoxy-3-methylindole |
| SMILES | COc1ccc2c(c1)c(C)cn2S(=O)(=O)c1ccc(Br)c(CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C22H26BrN3O3S/c1-16-14-26(22-7-4-18(29-3)13-20(16)22)30(27,28)19-5-6-21(23)17(12-19)15-25-10-8-24(2)9-11-25/h4-7,12-14H,8-11,15H2,1-3H3 |
| InChIKey | NXJCHOGDKIPOLM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |