C21H21O2PS — CID 11003128
diphenyl-(2,4,6-trimethylphenyl)sulfonylphosphane (PubChem CID 11003128) has the molecular formula C21H21O2PS and a molecular weight of 368.44 g/mol. Its IUPAC name is diphenyl-(2,4,6-trimethylphenyl)sulfonylphosphane.
| Compound Name | diphenyl-(2,4,6-trimethylphenyl)sulfonylphosphane |
|---|---|
| PubChem CID | 11003128 |
| Molecular Formula | C21H21O2PS |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | diphenyl-(2,4,6-trimethylphenyl)sulfonylphosphane |
| SMILES | Cc1cc(C)c(S(=O)(=O)P(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H21O2PS/c1-16-14-17(2)21(18(3)15-16)25(22,23)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3 |
| InChIKey | MGHNQOFXIOYIRY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|