C24H26N2O4S2 — CID 1036909
(2S)-1-(benzenesulfonyl)-2-phenyl-3-(2,4,6-trimethylphenyl)sulfonylimidazolidine (PubChem CID 1036909) has the molecular formula C24H26N2O4S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-2-phenyl-3-(2,4,6-trimethylphenyl)sulfonylimidazolidine.
| Compound Name | (2S)-1-(benzenesulfonyl)-2-phenyl-3-(2,4,6-trimethylphenyl)sulfonylimidazolidine |
|---|---|
| PubChem CID | 1036909 |
| Molecular Formula | C24H26N2O4S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-2-phenyl-3-(2,4,6-trimethylphenyl)sulfonylimidazolidine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccccc3)[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H26N2O4S2/c1-18-16-19(2)23(20(3)17-18)32(29,30)26-15-14-25(24(26)21-10-6-4-7-11-21)31(27,28)22-12-8-5-9-13-22/h4-13,16-17,24H,14-15H2,1-3H3/t24-/m0/s1 |
| InChIKey | WQMDDCNAYUWQRZ-DEOSSOPVSA-N |
| XLogP | 4.01 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |