C17H18N2O3S — CID 742548
1-[(2R)-3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]ethanone (PubChem CID 742548) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-[(2R)-3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 742548 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[(2R)-3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-14(20)18-12-13-19(17(18)15-8-4-2-5-9-15)23(21,22)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | WRSGAZVHVJMIAC-QGZVFWFLSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |