C35H38N2O5S2 — CID 11093403
(2S,3S)-2,3-diphenyl-1,4-bis[(2,4,6-trimethylphenyl)sulfonyl]-1,4-diazepan-6-one (PubChem CID 11093403) has the molecular formula C35H38N2O5S2 and a molecular weight of 630.83 g/mol. Its IUPAC name is (2S,3S)-2,3-diphenyl-1,4-bis[(2,4,6-trimethylphenyl)sulfonyl]-1,4-diazepan-6-one.
| Compound Name | (2S,3S)-2,3-diphenyl-1,4-bis[(2,4,6-trimethylphenyl)sulfonyl]-1,4-diazepan-6-one |
|---|---|
| PubChem CID | 11093403 |
| Molecular Formula | C35H38N2O5S2 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | (2S,3S)-2,3-diphenyl-1,4-bis[(2,4,6-trimethylphenyl)sulfonyl]-1,4-diazepan-6-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CC(=O)CN(S(=O)(=O)c3c(C)cc(C)cc3C)[C@@H](c3ccccc3)[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C35H38N2O5S2/c1-23-17-25(3)34(26(4)18-23)43(39,40)36-21-31(38)22-37(44(41,42)35-27(5)19-24(2)20-28(35)6)33(30-15-11-8-12-16-30)32(36)29-13-9-7-10-14-29/h7-20,32-33H,21-22H2,1-6H3/t32-,33-/m0/s1 |
| InChIKey | PZUGNGNQWQPQNE-LQJZCPKCSA-N |
| XLogP | 6.28 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |