C31H35NO2S — CID 101255729
(3S,3aS,9S,9aR)-4-methylidene-9-phenyl-3-propan-2-yl-2-(2,4,6-trimethylphenyl)sulfonyl-3,3a,9,9a-tetrahydro-1H-benzo[f]isoindole (PubChem CID 101255729) has the molecular formula C31H35NO2S and a molecular weight of 485.69 g/mol. Its IUPAC name is (3S,3aS,9S,9aR)-4-methylidene-9-phenyl-3-propan-2-yl-2-(2,4,6-trimethylphenyl)sulfonyl-3,3a,9,9a-tetrahydro-1H-benzo[f]isoindole.
| Compound Name | (3S,3aS,9S,9aR)-4-methylidene-9-phenyl-3-propan-2-yl-2-(2,4,6-trimethylphenyl)sulfonyl-3,3a,9,9a-tetrahydro-1H-benzo[f]isoindole |
|---|---|
| PubChem CID | 101255729 |
| Molecular Formula | C31H35NO2S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | (3S,3aS,9S,9aR)-4-methylidene-9-phenyl-3-propan-2-yl-2-(2,4,6-trimethylphenyl)sulfonyl-3,3a,9,9a-tetrahydro-1H-benzo[f]isoindole |
| SMILES | C=C1c2ccccc2[C@H](c2ccccc2)[C@H]2CN(S(=O)(=O)c3c(C)cc(C)cc3C)[C@@H](C(C)C)[C@H]12 |
| InChI | InChI=1S/C31H35NO2S/c1-19(2)30-28-23(6)25-14-10-11-15-26(25)29(24-12-8-7-9-13-24)27(28)18-32(30)35(33,34)31-21(4)16-20(3)17-22(31)5/h7-17,19,27-30H,6,18H2,1-5H3/t27-,28+,29-,30-/m0/s1 |
| InChIKey | KFODEHYYTOSZEU-XJYHXZFBSA-N |
| XLogP | 6.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |