C29H33N3O2S — CID 16723244
(5aS,6S,8aS,9S)-5-methylidene-9-phenyl-6-propan-2-yl-7-(2,4,6-trimethylphenyl)sulfonyl-6,8,8a,9-tetrahydro-5aH-pyrrolo[3,4-g]quinazoline (PubChem CID 16723244) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is (5aS,6S,8aS,9S)-5-methylidene-9-phenyl-6-propan-2-yl-7-(2,4,6-trimethylphenyl)sulfonyl-6,8,8a,9-tetrahydro-5aH-pyrrolo[3,4-g]quinazoline.
| Compound Name | (5aS,6S,8aS,9S)-5-methylidene-9-phenyl-6-propan-2-yl-7-(2,4,6-trimethylphenyl)sulfonyl-6,8,8a,9-tetrahydro-5aH-pyrrolo[3,4-g]quinazoline |
|---|---|
| PubChem CID | 16723244 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (5aS,6S,8aS,9S)-5-methylidene-9-phenyl-6-propan-2-yl-7-(2,4,6-trimethylphenyl)sulfonyl-6,8,8a,9-tetrahydro-5aH-pyrrolo[3,4-g]quinazoline |
| SMILES | C=C1c2cncnc2[C@H](c2ccccc2)[C@H]2CN(S(=O)(=O)c3c(C)cc(C)cc3C)[C@@H](C(C)C)[C@H]12 |
| InChI | InChI=1S/C29H33N3O2S/c1-17(2)28-25-21(6)23-14-30-16-31-27(23)26(22-10-8-7-9-11-22)24(25)15-32(28)35(33,34)29-19(4)12-18(3)13-20(29)5/h7-14,16-17,24-26,28H,6,15H2,1-5H3/t24-,25+,26+,28-/m0/s1 |
| InChIKey | WLSCZMDRHQOSDN-NLFSJDMNSA-N |
| XLogP | 5.52 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |