C19H26N2O2SSi — CID 11337814
trimethyl-[(2R,3S)-3-pyridin-3-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]silane (PubChem CID 11337814) has the molecular formula C19H26N2O2SSi and a molecular weight of 374.58 g/mol. Its IUPAC name is trimethyl-[(2R,3S)-3-pyridin-3-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]silane.
| Compound Name | trimethyl-[(2R,3S)-3-pyridin-3-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]silane |
|---|---|
| PubChem CID | 11337814 |
| Molecular Formula | C19H26N2O2SSi |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | trimethyl-[(2R,3S)-3-pyridin-3-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]silane |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2[C@H]([Si](C)(C)C)[C@@H]2c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C19H26N2O2SSi/c1-13-10-14(2)18(15(3)11-13)24(22,23)21-17(19(21)25(4,5)6)16-8-7-9-20-12-16/h7-12,17,19H,1-6H3/t17-,19+,21?/m0/s1 |
| InChIKey | DFOCTPGLHYCANB-FOHCZPNYSA-N |
| XLogP | 4.00 |
| TPSA | 50.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|