C23H29NO2S — CID 134983776
(2R,3S)-2-[(Z)-1-phenylprop-1-enyl]-3-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridine (PubChem CID 134983776) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is (2R,3S)-2-[(Z)-1-phenylprop-1-enyl]-3-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridine.
| Compound Name | (2R,3S)-2-[(Z)-1-phenylprop-1-enyl]-3-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 134983776 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2R,3S)-2-[(Z)-1-phenylprop-1-enyl]-3-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfonylaziridine |
| SMILES | C/C=C(/c1ccccc1)[C@@H]1[C@H](C(C)C)N1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H29NO2S/c1-7-20(19-11-9-8-10-12-19)22-21(15(2)3)24(22)27(25,26)23-17(5)13-16(4)14-18(23)6/h7-15,21-22H,1-6H3/b20-7-/t21-,22+,24?/m0/s1 |
| InChIKey | RYIIIOOSRAJWQH-OPTXWKSTSA-N |
| XLogP | 5.11 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|