C27H29NO2S — CID 10812595
(2S,3R)-2-benzyl-3-[(E)-1-phenylprop-1-enyl]-1-(2,4,6-trimethylphenyl)sulfonylaziridine (PubChem CID 10812595) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-3-[(E)-1-phenylprop-1-enyl]-1-(2,4,6-trimethylphenyl)sulfonylaziridine.
| Compound Name | (2S,3R)-2-benzyl-3-[(E)-1-phenylprop-1-enyl]-1-(2,4,6-trimethylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 10812595 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (2S,3R)-2-benzyl-3-[(E)-1-phenylprop-1-enyl]-1-(2,4,6-trimethylphenyl)sulfonylaziridine |
| SMILES | C/C=C(\c1ccccc1)[C@@H]1[C@H](Cc2ccccc2)N1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C27H29NO2S/c1-5-24(23-14-10-7-11-15-23)26-25(18-22-12-8-6-9-13-22)28(26)31(29,30)27-20(3)16-19(2)17-21(27)4/h5-17,25-26H,18H2,1-4H3/b24-5+/t25-,26+,28?/m0/s1 |
| InChIKey | OKBLRTHKXTYJBY-JIBNIPHWSA-N |
| XLogP | 5.70 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|