C22H30N2O2S — CID 110657731
1-benzyl-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine (PubChem CID 110657731) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-benzyl-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-benzyl-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 110657731 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-benzyl-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CC(C)N(Cc3ccccc3)C(C)C2)c(C)c1 |
| InChI | InChI=1S/C22H30N2O2S/c1-16-11-17(2)22(18(3)12-16)27(25,26)23-13-19(4)24(20(5)14-23)15-21-9-7-6-8-10-21/h6-12,19-20H,13-15H2,1-5H3 |
| InChIKey | PPJUNLPHJHILOW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |