C20H25ClN2O2S — CID 110657740
1-benzyl-4-(3-chloro-4-methylphenyl)sulfonyl-2,6-dimethylpiperazine (PubChem CID 110657740) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is 1-benzyl-4-(3-chloro-4-methylphenyl)sulfonyl-2,6-dimethylpiperazine.
| Compound Name | 1-benzyl-4-(3-chloro-4-methylphenyl)sulfonyl-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 110657740 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-benzyl-4-(3-chloro-4-methylphenyl)sulfonyl-2,6-dimethylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)N(Cc3ccccc3)C(C)C2)cc1Cl |
| InChI | InChI=1S/C20H25ClN2O2S/c1-15-9-10-19(11-20(15)21)26(24,25)22-12-16(2)23(17(3)13-22)14-18-7-5-4-6-8-18/h4-11,16-17H,12-14H2,1-3H3 |
| InChIKey | HNBQGIHDLDUAGP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |