C21H27N3O3S — CID 110657741
N-[4-(4-benzyl-3,5-dimethylpiperazin-1-yl)sulfonylphenyl]acetamide (PubChem CID 110657741) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[4-(4-benzyl-3,5-dimethylpiperazin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | N-[4-(4-benzyl-3,5-dimethylpiperazin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 110657741 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[4-(4-benzyl-3,5-dimethylpiperazin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC(C)N(Cc3ccccc3)C(C)C2)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-16-13-23(14-17(2)24(16)15-19-7-5-4-6-8-19)28(26,27)21-11-9-20(10-12-21)22-18(3)25/h4-12,16-17H,13-15H2,1-3H3,(H,22,25) |
| InChIKey | BDCVPAPMFNSMAD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |