C24H30N2O4S — CID 11732934
(2S,4S)-2-(2-methylpropyl)-4-[1-(3-nitrophenyl)ethenyl]-1-(2,4,6-trimethylphenyl)sulfonylazetidine (PubChem CID 11732934) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (2S,4S)-2-(2-methylpropyl)-4-[1-(3-nitrophenyl)ethenyl]-1-(2,4,6-trimethylphenyl)sulfonylazetidine.
| Compound Name | (2S,4S)-2-(2-methylpropyl)-4-[1-(3-nitrophenyl)ethenyl]-1-(2,4,6-trimethylphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 11732934 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2S,4S)-2-(2-methylpropyl)-4-[1-(3-nitrophenyl)ethenyl]-1-(2,4,6-trimethylphenyl)sulfonylazetidine |
| SMILES | C=C(c1cccc([N+](=O)[O-])c1)[C@@H]1C[C@H](CC(C)C)N1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H30N2O4S/c1-15(2)10-22-14-23(19(6)20-8-7-9-21(13-20)26(27)28)25(22)31(29,30)24-17(4)11-16(3)12-18(24)5/h7-9,11-13,15,22-23H,6,10,14H2,1-5H3/t22-,23-/m0/s1 |
| InChIKey | XCOGCUVIWZJHSN-GOTSBHOMSA-N |
| XLogP | 5.41 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|