C18H25NO4S — CID 25158165
tert-butyl (Z)-3-[(2S)-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]prop-2-enoate (PubChem CID 25158165) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is tert-butyl (Z)-3-[(2S)-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]prop-2-enoate.
| Compound Name | tert-butyl (Z)-3-[(2S)-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 25158165 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | tert-butyl (Z)-3-[(2S)-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]prop-2-enoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2C[C@@H]2/C=C\C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H25NO4S/c1-12-9-13(2)17(14(3)10-12)24(21,22)19-11-15(19)7-8-16(20)23-18(4,5)6/h7-10,15H,11H2,1-6H3/b8-7-/t15-,19?/m0/s1 |
| InChIKey | NMIHFSSDWJOZEN-ZPCFBNSYSA-N |
| XLogP | 2.88 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|