C24H29NO4S — CID 102401002
tert-butyl (E)-3-[(3R)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-4-yl]prop-2-enoate (PubChem CID 102401002) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is tert-butyl (E)-3-[(3R)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-4-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(3R)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102401002 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | tert-butyl (E)-3-[(3R)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-4-yl]prop-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C)c3c2ccc(C)c3/C=C/C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-16-7-10-19(11-8-16)30(27,28)25-15-18(3)23-20(17(2)9-13-21(23)25)12-14-22(26)29-24(4,5)6/h7-14,18H,15H2,1-6H3/b14-12+/t18-/m0/s1 |
| InChIKey | ALGHLSSJAJOALN-SZEUEKNRSA-N |
| XLogP | 4.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|