C24H29NO5S — CID 25228754
tert-butyl (E)-3-[6-methoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-yl]prop-2-enoate (PubChem CID 25228754) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is tert-butyl (E)-3-[6-methoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[6-methoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 25228754 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | tert-butyl (E)-3-[6-methoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-yl]prop-2-enoate |
| SMILES | COc1ccc2c(c1/C=C/C(=O)OC(C)(C)C)CCN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C24H29NO5S/c1-17-6-9-19(10-7-17)31(27,28)25-15-14-20-18(16-25)8-12-22(29-5)21(20)11-13-23(26)30-24(2,3)4/h6-13H,14-16H2,1-5H3/b13-11+ |
| InChIKey | NTVDBQINRAQVGC-ACCUITESSA-N |
| XLogP | 4.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|