C19H21NO3S — CID 170223842
(3R)-3-ethyl-5-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-4-carbaldehyde (PubChem CID 170223842) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3R)-3-ethyl-5-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-4-carbaldehyde.
| Compound Name | (3R)-3-ethyl-5-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-4-carbaldehyde |
|---|---|
| PubChem CID | 170223842 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3R)-3-ethyl-5-methyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-4-carbaldehyde |
| SMILES | CC[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)c2ccc(C)c(C=O)c21 |
| InChI | InChI=1S/C19H21NO3S/c1-4-15-11-20(18-10-7-14(3)17(12-21)19(15)18)24(22,23)16-8-5-13(2)6-9-16/h5-10,12,15H,4,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | OAURADQIJAUTRL-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|