C26H37NO9P2S — CID 86748669
3-[2,2-bis(diethoxyphosphoryl)ethyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one (PubChem CID 86748669) has the molecular formula C26H37NO9P2S and a molecular weight of 601.60 g/mol. Its IUPAC name is 3-[2,2-bis(diethoxyphosphoryl)ethyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one.
| Compound Name | 3-[2,2-bis(diethoxyphosphoryl)ethyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 86748669 |
| Molecular Formula | C26H37NO9P2S |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | 3-[2,2-bis(diethoxyphosphoryl)ethyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
| SMILES | CCOP(=O)(OCC)C(CC1CN(S(=O)(=O)c2ccc(C)cc2)c2ccccc2C1=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C26H37NO9P2S/c1-6-33-37(29,34-7-2)25(38(30,35-8-3)36-9-4)18-21-19-27(24-13-11-10-12-23(24)26(21)28)39(31,32)22-16-14-20(5)15-17-22/h10-17,21,25H,6-9,18-19H2,1-5H3 |
| InChIKey | XWBQRVGTHXHPKL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|