C18H17NO4S — CID 44723400
(4Z)-4-(hydroxymethylidene)-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-one (PubChem CID 44723400) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is (4Z)-4-(hydroxymethylidene)-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-one.
| Compound Name | (4Z)-4-(hydroxymethylidene)-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-one |
|---|---|
| PubChem CID | 44723400 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (4Z)-4-(hydroxymethylidene)-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC/C(=C/O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H17NO4S/c1-13-6-8-15(9-7-13)24(22,23)19-11-10-14(12-20)18(21)16-4-2-3-5-17(16)19/h2-9,12,20H,10-11H2,1H3/b14-12- |
| InChIKey | MJUKZBJGABHRKS-OWBHPGMISA-N |
| XLogP | 3.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|