C19H17F2NO4S — CID 18324689
(2E)-2-[4,4-difluoro-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid (PubChem CID 18324689) has the molecular formula C19H17F2NO4S and a molecular weight of 393.41 g/mol. Its IUPAC name is (2E)-2-[4,4-difluoro-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid.
| Compound Name | (2E)-2-[4,4-difluoro-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 18324689 |
| Molecular Formula | C19H17F2NO4S |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (2E)-2-[4,4-difluoro-1-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(F)(F)/C(=C/C(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H17F2NO4S/c1-13-6-8-14(9-7-13)27(25,26)22-11-10-19(20,21)16(12-18(23)24)15-4-2-3-5-17(15)22/h2-9,12H,10-11H2,1H3,(H,23,24)/b16-12+ |
| InChIKey | GXSFYKWZCXJPSF-FOWTUZBSSA-N |
| XLogP | 3.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|