C24H23NO3S — CID 164665252
4-(2-ethenylphenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-ol (PubChem CID 164665252) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-(2-ethenylphenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-ol.
| Compound Name | 4-(2-ethenylphenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-ol |
|---|---|
| PubChem CID | 164665252 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-(2-ethenylphenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-ol |
| SMILES | C=Cc1ccccc1C1(O)CCN(S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H23NO3S/c1-3-19-8-4-5-9-21(19)24(26)16-17-25(23-11-7-6-10-22(23)24)29(27,28)20-14-12-18(2)13-15-20/h3-15,26H,1,16-17H2,2H3 |
| InChIKey | YAJMQOXRKVENCR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |