C18H21NO2S — CID 91938897
4,4-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinoline (PubChem CID 91938897) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 4,4-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinoline.
| Compound Name | 4,4-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 91938897 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4,4-dimethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C)(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NO2S/c1-14-8-10-15(11-9-14)22(20,21)19-13-12-18(2,3)16-6-4-5-7-17(16)19/h4-11H,12-13H2,1-3H3 |
| InChIKey | OPIQJXUYBAGSFH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |