C21H25NO4S — CID 14422762
6-hydroxy-1-(4-methylphenyl)sulfonyl-3-pentyl-2,3-dihydroquinolin-4-one (PubChem CID 14422762) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methylphenyl)sulfonyl-3-pentyl-2,3-dihydroquinolin-4-one.
| Compound Name | 6-hydroxy-1-(4-methylphenyl)sulfonyl-3-pentyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 14422762 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-hydroxy-1-(4-methylphenyl)sulfonyl-3-pentyl-2,3-dihydroquinolin-4-one |
| SMILES | CCCCCC1CN(S(=O)(=O)c2ccc(C)cc2)c2ccc(O)cc2C1=O |
| InChI | InChI=1S/C21H25NO4S/c1-3-4-5-6-16-14-22(20-12-9-17(23)13-19(20)21(16)24)27(25,26)18-10-7-15(2)8-11-18/h7-13,16,23H,3-6,14H2,1-2H3 |
| InChIKey | RKMOGLDAVVVLCJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|