C19H33ClN2O2S — CID 10905200
1-(4-methylphenyl)sulfonyl-3-octylpiperazin-4-ium chloride (PubChem CID 10905200) has the molecular formula C19H33ClN2O2S and a molecular weight of 389.01 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-octylpiperazin-4-ium chloride.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-octylpiperazin-4-ium chloride |
|---|---|
| PubChem CID | 10905200 |
| Molecular Formula | C19H33ClN2O2S |
| Molecular Weight | 389.01 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-octylpiperazin-4-ium chloride |
| SMILES | CCCCCCCCC1CN(S(=O)(=O)c2ccc(C)cc2)CC[NH2+]1.[Cl-] |
| InChI | InChI=1S/C19H32N2O2S.ClH/c1-3-4-5-6-7-8-9-18-16-21(15-14-20-18)24(22,23)19-12-10-17(2)11-13-19;/h10-13,18,20H,3-9,14-16H2,1-2H3;1H |
| InChIKey | USNBPXRMMINKBO-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.01 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|