C21H34ClNO2S — CID 45258573
(2S,3S,4R)-4-chloro-3-ethyl-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine (PubChem CID 45258573) has the molecular formula C21H34ClNO2S and a molecular weight of 400.03 g/mol. Its IUPAC name is (2S,3S,4R)-4-chloro-3-ethyl-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | (2S,3S,4R)-4-chloro-3-ethyl-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 45258573 |
| Molecular Formula | C21H34ClNO2S |
| Molecular Weight | 400.03 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2S,3S,4R)-4-chloro-3-ethyl-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine |
| SMILES | CCCCCCC[C@H]1[C@H](CC)[C@H](Cl)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H34ClNO2S/c1-4-6-7-8-9-10-21-19(5-2)20(22)15-16-23(21)26(24,25)18-13-11-17(3)12-14-18/h11-14,19-21H,4-10,15-16H2,1-3H3/t19-,20-,21+/m1/s1 |
| InChIKey | MJTCJEONDQVGBB-NJYVYQBISA-N |
| XLogP | 5.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|