C17H29ClN2O2S — CID 11121973
2-hexyl-1-(4-methylphenyl)sulfonylpiperazin-4-ium chloride (PubChem CID 11121973) has the molecular formula C17H29ClN2O2S and a molecular weight of 360.95 g/mol. Its IUPAC name is 2-hexyl-1-(4-methylphenyl)sulfonylpiperazin-4-ium chloride.
| Compound Name | 2-hexyl-1-(4-methylphenyl)sulfonylpiperazin-4-ium chloride |
|---|---|
| PubChem CID | 11121973 |
| Molecular Formula | C17H29ClN2O2S |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-hexyl-1-(4-methylphenyl)sulfonylpiperazin-4-ium chloride |
| SMILES | CCCCCCC1C[NH2+]CCN1S(=O)(=O)c1ccc(C)cc1.[Cl-] |
| InChI | InChI=1S/C17H28N2O2S.ClH/c1-3-4-5-6-7-16-14-18-12-13-19(16)22(20,21)17-10-8-15(2)9-11-17;/h8-11,16,18H,3-7,12-14H2,1-2H3;1H |
| InChIKey | ATELJVODTXNMDB-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|