C19H30N2O2S — CID 102384611
2-methyl-1-(4-methylphenyl)sulfonyl-5-octyl-4,5-dihydroimidazole (PubChem CID 102384611) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 2-methyl-1-(4-methylphenyl)sulfonyl-5-octyl-4,5-dihydroimidazole.
| Compound Name | 2-methyl-1-(4-methylphenyl)sulfonyl-5-octyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 102384611 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-methyl-1-(4-methylphenyl)sulfonyl-5-octyl-4,5-dihydroimidazole |
| SMILES | CCCCCCCCC1CN=C(C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H30N2O2S/c1-4-5-6-7-8-9-10-18-15-20-17(3)21(18)24(22,23)19-13-11-16(2)12-14-19/h11-14,18H,4-10,15H2,1-3H3 |
| InChIKey | FUPLWRKHBYGZLZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|