C30H33Cl2NO2S — CID 154714751
(2S)-4,5-bis(4-chlorophenyl)-2-heptyl-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole (PubChem CID 154714751) has the molecular formula C30H33Cl2NO2S and a molecular weight of 542.57 g/mol. Its IUPAC name is (2S)-4,5-bis(4-chlorophenyl)-2-heptyl-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole.
| Compound Name | (2S)-4,5-bis(4-chlorophenyl)-2-heptyl-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 154714751 |
| Molecular Formula | C30H33Cl2NO2S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (2S)-4,5-bis(4-chlorophenyl)-2-heptyl-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole |
| SMILES | CCCCCCC[C@H]1CC(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H33Cl2NO2S/c1-3-4-5-6-7-8-27-21-29(23-11-15-25(31)16-12-23)30(24-13-17-26(32)18-14-24)33(27)36(34,35)28-19-9-22(2)10-20-28/h9-20,27H,3-8,21H2,1-2H3/t27-/m0/s1 |
| InChIKey | QJAQTYUPMVPOKT-MHZLTWQESA-N |
| XLogP | 8.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|