About (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one
(2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one (PubChem CID 59342378) has the molecular formula C15H20ClNO3S
and a molecular weight of 329.85 g/mol. Its IUPAC name is (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one.
Molecular Properties
| Compound Name | (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one |
| PubChem CID | 59342378 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one |
| SMILES | CC[C@@H]1CC(=O)C[C@H](CC)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO3S/c1-3-12-9-14(18)10-13(4-2)17(12)21(19,20)15-7-5-11(16)6-8-15/h5-8,12-13H,3-4,9-10H2,1-2H3/t12-,13+ |
| InChIKey | NVZMEKODMXDZGU-BETUJISGSA-N |
| XLogP | 3.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one?
The IUPAC name of (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one (CID 59342378) is (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one.
What is the SMILES notation for (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one?
The canonical SMILES for (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one is CC[C@@H]1CC(=O)C[C@H](CC)N1S(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one?
The InChIKey is NVZMEKODMXDZGU-BETUJISGSA-N. The full InChI is InChI=1S/C15H20ClNO3S/c1-3-12-9-14(18)10-13(4-2)17(12)21(19,20)15-7-5-11(16)6-8-15/h5-8,12-13H,3-4,9-10H2,1-2H3/t12-,13+.
What are the key properties of (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one?
(2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one has a molecular weight of 329.85 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-1-(4-chlorophenyl)sulfonyl-2,6-diethylpiperidin-4-one is sourced from PubChem (CID 59342378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).