C19H32ClNO4SSi — CID 58639775
[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methanol (PubChem CID 58639775) has the molecular formula C19H32ClNO4SSi and a molecular weight of 434.07 g/mol. Its IUPAC name is [6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methanol.
| Compound Name | [6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 58639775 |
| Molecular Formula | C19H32ClNO4SSi |
| Molecular Weight | 434.07 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonylpiperidin-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCCC(CO)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H32ClNO4SSi/c1-19(2,3)27(4,5)25-14-17-8-6-7-16(13-22)21(17)26(23,24)18-11-9-15(20)10-12-18/h9-12,16-17,22H,6-8,13-14H2,1-5H3 |
| InChIKey | WIJBJTBCWJXPCP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.07 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|