C19H32ClN3O4SSi — CID 58932409
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonyl-N'-hydroxypiperidine-2-carboximidamide (PubChem CID 58932409) has the molecular formula C19H32ClN3O4SSi and a molecular weight of 462.09 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonyl-N'-hydroxypiperidine-2-carboximidamide.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonyl-N'-hydroxypiperidine-2-carboximidamide |
|---|---|
| PubChem CID | 58932409 |
| Molecular Formula | C19H32ClN3O4SSi |
| Molecular Weight | 462.09 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-chlorophenyl)sulfonyl-N'-hydroxypiperidine-2-carboximidamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCCC(/C(N)=N/O)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H32ClN3O4SSi/c1-19(2,3)29(4,5)27-13-15-7-6-8-17(18(21)22-24)23(15)28(25,26)16-11-9-14(20)10-12-16/h9-12,15,17,24H,6-8,13H2,1-5H3,(H2,21,22) |
| InChIKey | SSYMSOVJZFZDJB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.09 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|