C17H29NO3SSi — CID 10450874
tert-butyl-dimethyl-[[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methoxy]silane (PubChem CID 10450874) has the molecular formula C17H29NO3SSi and a molecular weight of 355.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 10450874 |
| Molecular Formula | C17H29NO3SSi |
| Molecular Weight | 355.58 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methoxy]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](C)[C@@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO3SSi/c1-13-8-10-15(11-9-13)22(19,20)18-14(2)16(18)12-21-23(6,7)17(3,4)5/h8-11,14,16H,12H2,1-7H3/t14-,16-,18?/m0/s1 |
| InChIKey | RHEODUSXQOEWCW-CCLCZBONSA-N |
| XLogP | 3.78 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|