C18H29NO4SSi — CID 102585686
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 102585686) has the molecular formula C18H29NO4SSi and a molecular weight of 383.59 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102585686 |
| Molecular Formula | C18H29NO4SSi |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC[C@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO4SSi/c1-14-7-10-16(11-8-14)24(21,22)19-15(9-12-17(19)20)13-23-25(5,6)18(2,3)4/h7-8,10-11,15H,9,12-13H2,1-6H3/t15-/m0/s1 |
| InChIKey | LYPOBGJNCIWCKO-HNNXBMFYSA-N |
| XLogP | 3.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|