C13H26BrNO2Si — CID 10449657
1-(2-bromoethyl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-2-one (PubChem CID 10449657) has the molecular formula C13H26BrNO2Si and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-(2-bromoethyl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-2-one.
| Compound Name | 1-(2-bromoethyl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10449657 |
| Molecular Formula | C13H26BrNO2Si |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(2-bromoethyl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC(=O)N1CCBr |
| InChI | InChI=1S/C13H26BrNO2Si/c1-13(2,3)18(4,5)17-10-11-6-7-12(16)15(11)9-8-14/h11H,6-10H2,1-5H3 |
| InChIKey | ZGILSFJPCMEKIM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|