C14H27NO4Si — CID 174030231
methyl 2-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]acetate (PubChem CID 174030231) has the molecular formula C14H27NO4Si and a molecular weight of 301.46 g/mol. Its IUPAC name is methyl 2-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 174030231 |
| Molecular Formula | C14H27NO4Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl 2-[(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)CC[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO4Si/c1-14(2,3)20(5,6)19-10-11-7-8-12(16)15(11)9-13(17)18-4/h11H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | XCIQHCZLUUOBKE-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|