C15H26N2O5Si — CID 134974886
methyl 2-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4-methoxy-5-oxopyrrolidin-1-yl]acetate (PubChem CID 134974886) has the molecular formula C15H26N2O5Si and a molecular weight of 342.47 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4-methoxy-5-oxopyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4-methoxy-5-oxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 134974886 |
| Molecular Formula | C15H26N2O5Si |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl 2-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4-methoxy-5-oxopyrrolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C#N |
| InChI | InChI=1S/C15H26N2O5Si/c1-15(2,3)23(6,7)22-12-10(8-16)17(9-11(18)20-4)14(19)13(12)21-5/h10,12-13H,9H2,1-7H3/t10-,12+,13-/m1/s1 |
| InChIKey | GVBQZFZWKTXGAP-KGYLQXTDSA-N |
| XLogP | 1.30 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|