C17H35NO4Si2 — CID 10981612
(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylpyrrolidine-2,5-dione (PubChem CID 10981612) has the molecular formula C17H35NO4Si2 and a molecular weight of 373.64 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylpyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10981612 |
| Molecular Formula | C17H35NO4Si2 |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H35NO4Si2/c1-16(2,3)23(8,9)21-12-13(15(20)18(7)14(12)19)22-24(10,11)17(4,5)6/h12-13H,1-11H3/t12-,13-/m1/s1 |
| InChIKey | XZOPQYQTPYVDGC-CHWSQXEVSA-N |
| XLogP | 3.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|