C20H42O5Si2 — CID 134886690
(2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-one (PubChem CID 134886690) has the molecular formula C20H42O5Si2 and a molecular weight of 418.72 g/mol. Its IUPAC name is (2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 134886690 |
| Molecular Formula | C20H42O5Si2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2R,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(dimethoxymethyl)cyclopentan-1-one |
| SMILES | COC(OC)[C@H]1CC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O5Si2/c1-19(2,3)26(9,10)24-16-14(18(22-7)23-8)13-15(21)17(16)25-27(11,12)20(4,5)6/h14,16-18H,13H2,1-12H3/t14-,16+,17-/m0/s1 |
| InChIKey | JFPDAKDFSATRLZ-UAGQMJEPSA-N |
| XLogP | 4.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|