C36H81NO6Si5 — CID 101409259
(3R,4S,5S,6S)-1,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one (PubChem CID 101409259) has the molecular formula C36H81NO6Si5 and a molecular weight of 764.47 g/mol. Its IUPAC name is (3R,4S,5S,6S)-1,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one.
| Compound Name | (3R,4S,5S,6S)-1,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one |
|---|---|
| PubChem CID | 101409259 |
| Molecular Formula | C36H81NO6Si5 |
| Molecular Weight | 764.47 g/mol |
| Exact Mass | 763.49 |
| IUPAC Name | (3R,4S,5S,6S)-1,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H81NO6Si5/c1-32(2,3)44(16,17)39-26-27-28(40-45(18,19)33(4,5)6)29(41-46(20,21)34(7,8)9)30(42-47(22,23)35(10,11)12)31(38)37(27)43-48(24,25)36(13,14)15/h27-30H,26H2,1-25H3/t27-,28-,29-,30+/m0/s1 |
| InChIKey | BWXMMICTXFLYNT-GCXHJFECSA-N |
| XLogP | 11.33 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.47 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|