C27H53N3O8Si3 — CID 135065849
3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,3,5-triazepane-2,4,6,7-tetrone (PubChem CID 135065849) has the molecular formula C27H53N3O8Si3 and a molecular weight of 631.99 g/mol. Its IUPAC name is 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,3,5-triazepane-2,4,6,7-tetrone.
| Compound Name | 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,3,5-triazepane-2,4,6,7-tetrone |
|---|---|
| PubChem CID | 135065849 |
| Molecular Formula | C27H53N3O8Si3 |
| Molecular Weight | 631.99 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | 3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,3,5-triazepane-2,4,6,7-tetrone |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2c(=O)[nH]c(=O)c(=O)[nH]c2=O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H53N3O8Si3/c1-25(2,3)39(10,11)35-16-17-18(37-40(12,13)26(4,5)6)19(38-41(14,15)27(7,8)9)22(36-17)30-23(33)28-20(31)21(32)29-24(30)34/h17-19,22H,16H2,1-15H3,(H,28,31,33)(H,29,32,34) |
| InChIKey | QTNGXAVQZYJUAB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|