C28H57N5O5Si3 — CID 164756349
2-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]guanidine (PubChem CID 164756349) has the molecular formula C28H57N5O5Si3 and a molecular weight of 628.05 g/mol. Its IUPAC name is 2-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]guanidine.
| Compound Name | 2-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]guanidine |
|---|---|
| PubChem CID | 164756349 |
| Molecular Formula | C28H57N5O5Si3 |
| Molecular Weight | 628.05 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | 2-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]guanidine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(N=C(N)N)nc2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H57N5O5Si3/c1-26(2,3)39(10,11)35-18-19-21(37-40(12,13)27(4,5)6)22(38-41(14,15)28(7,8)9)23(36-19)33-17-16-20(31-24(29)30)32-25(33)34/h16-17,19,21-23H,18H2,1-15H3,(H4,29,30,31,32,34)/t19-,21-,22-,23-/m1/s1 |
| InChIKey | FGWINCJIXLSSEU-JMJGKCIBSA-N |
| XLogP | 5.85 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.05 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|