C17H31N3O5Si — CID 140810780
4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 140810780) has the molecular formula C17H31N3O5Si and a molecular weight of 385.54 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 140810780 |
| Molecular Formula | C17H31N3O5Si |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CCO[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C17H31N3O5Si/c1-7-23-14-13(25-26(5,6)17(2,3)4)11(10-21)24-15(14)20-9-8-12(18)19-16(20)22/h8-9,11,13-15,21H,7,10H2,1-6H3,(H2,18,19,22)/t11-,13-,14-,15-/m1/s1 |
| InChIKey | BISTUVMXPWENRA-NMFUWQPSSA-N |
| XLogP | 1.51 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|