C13H23N3O5Si — CID 10404320
4-amino-1-[3-[ethyl(dimethyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 10404320) has the molecular formula C13H23N3O5Si and a molecular weight of 329.43 g/mol. Its IUPAC name is 4-amino-1-[3-[ethyl(dimethyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3-[ethyl(dimethyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10404320 |
| Molecular Formula | C13H23N3O5Si |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-amino-1-[3-[ethyl(dimethyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[Si](C)(C)OC1C(O)C(CO)OC1n1ccc(N)nc1=O |
| InChI | InChI=1S/C13H23N3O5Si/c1-4-22(2,3)21-11-10(18)8(7-17)20-12(11)16-6-5-9(14)15-13(16)19/h5-6,8,10-12,17-18H,4,7H2,1-3H3,(H2,14,15,19) |
| InChIKey | NXWFLVJBNKSPMZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|