C11H17N3O5S — CID 54164899
4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(methylsulfanylmethoxy)oxolan-2-yl]pyrimidin-2-one (PubChem CID 54164899) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(methylsulfanylmethoxy)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(methylsulfanylmethoxy)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 54164899 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(methylsulfanylmethoxy)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CSCOC1C(O)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C11H17N3O5S/c1-20-5-18-9-8(16)6(4-15)19-10(9)14-3-2-7(12)13-11(14)17/h2-3,6,8-10,15-16H,4-5H2,1H3,(H2,12,13,17)/t6-,8?,9?,10-/m1/s1 |
| InChIKey | OQYLIGNGFZGZAA-UHMNONSZSA-N |
| XLogP | -1.22 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|