C18H24N3O5 — CID 10743429
CID 10743429 (PubChem CID 10743429) has the molecular formula C18H24N3O5 and a molecular weight of 362.41 g/mol.
| Compound Name | CID 10743429 |
|---|---|
| PubChem CID | 10743429 |
| Molecular Formula | C18H24N3O5 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | — |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OCCCC[C]2[CH][CH][CH][CH]2)c(=O)n1 |
| InChI | InChI=1S/C18H24N3O5/c19-14-8-9-21(18(24)20-14)17-16(15(23)13(11-22)26-17)25-10-4-3-7-12-5-1-2-6-12/h1-2,5-6,8-9,13,15-17,22-23H,3-4,7,10-11H2,(H2,19,20,24)/t13-,15-,16-,17-/m1/s1 |
| InChIKey | CFABNKBHBSMNEF-MWQQHZPXSA-N |
| XLogP | 0.04 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|