C22H32N3O5 — CID 10816251
CID 10816251 (PubChem CID 10816251) has the molecular formula C22H32N3O5 and a molecular weight of 418.51 g/mol.
| Compound Name | CID 10816251 |
|---|---|
| PubChem CID | 10816251 |
| Molecular Formula | C22H32N3O5 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | — |
| SMILES | CC(C)CNc1ccn([C@@H]2O[C@H](CO)[C@@H](OCCCC[C]3[CH][CH][CH][CH]3)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C22H32N3O5/c1-15(2)13-23-18-10-11-25(22(28)24-18)21-19(27)20(17(14-26)30-21)29-12-6-5-9-16-7-3-4-8-16/h3-4,7-8,10-11,15,17,19-21,26-27H,5-6,9,12-14H2,1-2H3,(H,23,24,28)/t17-,19-,20-,21-/m1/s1 |
| InChIKey | WCMSNOQFKJNACX-CWJKEVGVSA-N |
| XLogP | 1.52 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|