C21H41N3O5Si2 — CID 58763546
4-amino-1-[(2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 58763546) has the molecular formula C21H41N3O5Si2 and a molecular weight of 471.75 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 58763546 |
| Molecular Formula | C21H41N3O5Si2 |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 4-amino-1-[(2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C21H41N3O5Si2/c1-20(2,3)30(7,8)28-16-14(13-25)27-18(24-12-11-15(22)23-19(24)26)17(16)29-31(9,10)21(4,5)6/h11-12,14,16-18,25H,13H2,1-10H3,(H2,22,23,26)/t14-,16-,17+,18-/m1/s1 |
| InChIKey | BUXPAKUSVYSXKP-NRSFXHEJSA-N |
| XLogP | 3.50 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|